C18H21N2O+ — CID 6953798
1-phenyl-2-[(2R)-2-pyridin-3-ylpiperidin-1-ium-1-yl]ethanone (PubChem CID 6953798) has the molecular formula C18H21N2O+ and a molecular weight of 281.38 g/mol. Its IUPAC name is 1-phenyl-2-[(2R)-2-pyridin-3-ylpiperidin-1-ium-1-yl]ethanone.
| Compound Name | 1-phenyl-2-[(2R)-2-pyridin-3-ylpiperidin-1-ium-1-yl]ethanone |
|---|---|
| PubChem CID | 6953798 |
| Molecular Formula | C18H21N2O+ |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 1-phenyl-2-[(2R)-2-pyridin-3-ylpiperidin-1-ium-1-yl]ethanone |
| SMILES | O=C(C[NH+]1CCCC[C@@H]1c1cccnc1)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O/c21-18(15-7-2-1-3-8-15)14-20-12-5-4-10-17(20)16-9-6-11-19-13-16/h1-3,6-9,11,13,17H,4-5,10,12,14H2/p+1/t17-/m1/s1 |
| InChIKey | WLGJLFCYTIYRST-QGZVFWFLSA-O |
| XLogP | 2.07 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |