C19H27N2O+ — CID 4286975
1-[3-(2-pyridin-3-ylpiperidin-1-ium-1-yl)prop-1-ynyl]cyclohexan-1-ol (PubChem CID 4286975) has the molecular formula C19H27N2O+ and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-[3-(2-pyridin-3-ylpiperidin-1-ium-1-yl)prop-1-ynyl]cyclohexan-1-ol.
| Compound Name | 1-[3-(2-pyridin-3-ylpiperidin-1-ium-1-yl)prop-1-ynyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 4286975 |
| Molecular Formula | C19H27N2O+ |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 1-[3-(2-pyridin-3-ylpiperidin-1-ium-1-yl)prop-1-ynyl]cyclohexan-1-ol |
| SMILES | OC1(C#CC[NH+]2CCCCC2c2cccnc2)CCCCC1 |
| InChI | InChI=1S/C19H26N2O/c22-19(10-3-1-4-11-19)12-7-15-21-14-5-2-9-18(21)17-8-6-13-20-16-17/h6,8,13,16,18,22H,1-5,9-11,14-15H2/p+1 |
| InChIKey | LAPSZKYJGURCAU-UHFFFAOYSA-O |
| XLogP | 1.89 |
| TPSA | 37.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|