C31H52N2O — CID 25427498
(4R,8S,12R)-4,8,12,16-tetramethyl-1-[(2R)-2-pyridin-3-ylpiperidin-1-yl]heptadec-2-yn-4-ol (PubChem CID 25427498) has the molecular formula C31H52N2O and a molecular weight of 468.77 g/mol. Its IUPAC name is (4R,8S,12R)-4,8,12,16-tetramethyl-1-[(2R)-2-pyridin-3-ylpiperidin-1-yl]heptadec-2-yn-4-ol.
| Compound Name | (4R,8S,12R)-4,8,12,16-tetramethyl-1-[(2R)-2-pyridin-3-ylpiperidin-1-yl]heptadec-2-yn-4-ol |
|---|---|
| PubChem CID | 25427498 |
| Molecular Formula | C31H52N2O |
| Molecular Weight | 468.77 g/mol |
| Exact Mass | 468.41 |
| IUPAC Name | (4R,8S,12R)-4,8,12,16-tetramethyl-1-[(2R)-2-pyridin-3-ylpiperidin-1-yl]heptadec-2-yn-4-ol |
| SMILES | CC(C)CCC[C@@H](C)CCC[C@H](C)CCC[C@@](C)(O)C#CCN1CCCC[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C31H52N2O/c1-26(2)13-8-14-27(3)15-9-16-28(4)17-10-20-31(5,34)21-12-24-33-23-7-6-19-30(33)29-18-11-22-32-25-29/h11,18,22,25-28,30,34H,6-10,13-17,19-20,23-24H2,1-5H3/t27-,28+,30-,31-/m1/s1 |
| InChIKey | GCGPCCBFTOUOSH-UVXOPOLESA-N |
| XLogP | 7.80 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.77 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|