C22H37N3O2 — CID 102540942
tert-butyl N-[5-[1-(2-methylpropyl)piperidin-2-yl]-2-pyridinyl]-N-propan-2-ylcarbamate (PubChem CID 102540942) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is tert-butyl N-[5-[1-(2-methylpropyl)piperidin-2-yl]-2-pyridinyl]-N-propan-2-ylcarbamate.
| Compound Name | tert-butyl N-[5-[1-(2-methylpropyl)piperidin-2-yl]-2-pyridinyl]-N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 102540942 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | tert-butyl N-[5-[1-(2-methylpropyl)piperidin-2-yl]-2-pyridinyl]-N-propan-2-ylcarbamate |
| SMILES | CC(C)CN1CCCCC1c1ccc(N(C(=O)OC(C)(C)C)C(C)C)nc1 |
| InChI | InChI=1S/C22H37N3O2/c1-16(2)15-24-13-9-8-10-19(24)18-11-12-20(23-14-18)25(17(3)4)21(26)27-22(5,6)7/h11-12,14,16-17,19H,8-10,13,15H2,1-7H3 |
| InChIKey | NKOMTUGBRZDLPM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |