C22H37N3O2 — CID 102540996
tert-butyl N-butyl-N-[5-[1-(2-methylpropyl)pyrrolidin-2-yl]-2-pyridinyl]carbamate (PubChem CID 102540996) has the molecular formula C22H37N3O2 and a molecular weight of 375.56 g/mol. Its IUPAC name is tert-butyl N-butyl-N-[5-[1-(2-methylpropyl)pyrrolidin-2-yl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-butyl-N-[5-[1-(2-methylpropyl)pyrrolidin-2-yl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 102540996 |
| Molecular Formula | C22H37N3O2 |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.29 |
| IUPAC Name | tert-butyl N-butyl-N-[5-[1-(2-methylpropyl)pyrrolidin-2-yl]-2-pyridinyl]carbamate |
| SMILES | CCCCN(C(=O)OC(C)(C)C)c1ccc(C2CCCN2CC(C)C)cn1 |
| InChI | InChI=1S/C22H37N3O2/c1-7-8-14-25(21(26)27-22(4,5)6)20-12-11-18(15-23-20)19-10-9-13-24(19)16-17(2)3/h11-12,15,17,19H,7-10,13-14,16H2,1-6H3 |
| InChIKey | JBUQWCHEUQYVJV-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |