C26H37N3O4S — CID 102541014
tert-butyl N-butyl-N-[5-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]-2-pyridinyl]carbamate (PubChem CID 102541014) has the molecular formula C26H37N3O4S and a molecular weight of 487.67 g/mol. Its IUPAC name is tert-butyl N-butyl-N-[5-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-butyl-N-[5-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 102541014 |
| Molecular Formula | C26H37N3O4S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | tert-butyl N-butyl-N-[5-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]-2-pyridinyl]carbamate |
| SMILES | CCCCN(C(=O)OC(C)(C)C)c1ccc(C2CCCCN2S(=O)(=O)c2ccc(C)cc2)cn1 |
| InChI | InChI=1S/C26H37N3O4S/c1-6-7-17-28(25(30)33-26(3,4)5)24-16-13-21(19-27-24)23-10-8-9-18-29(23)34(31,32)22-14-11-20(2)12-15-22/h11-16,19,23H,6-10,17-18H2,1-5H3 |
| InChIKey | FUEACLLCPBTWHG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |