C24H33N3O4S — CID 102540918
tert-butyl N-ethyl-N-[3-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]-2-pyridinyl]carbamate (PubChem CID 102540918) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[3-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[3-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 102540918 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | tert-butyl N-ethyl-N-[3-[1-(4-methylphenyl)sulfonylpiperidin-2-yl]-2-pyridinyl]carbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)c1ncccc1C1CCCCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H33N3O4S/c1-6-26(23(28)31-24(3,4)5)22-20(10-9-16-25-22)21-11-7-8-17-27(21)32(29,30)19-14-12-18(2)13-15-19/h9-10,12-16,21H,6-8,11,17H2,1-5H3 |
| InChIKey | CCVFQJJPZCQGQN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |