C20H33N3O2 — CID 102540875
tert-butyl N-[3-(1-ethylpiperidin-2-yl)-2-pyridinyl]-N-propylcarbamate (PubChem CID 102540875) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is tert-butyl N-[3-(1-ethylpiperidin-2-yl)-2-pyridinyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[3-(1-ethylpiperidin-2-yl)-2-pyridinyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 102540875 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | tert-butyl N-[3-(1-ethylpiperidin-2-yl)-2-pyridinyl]-N-propylcarbamate |
| SMILES | CCCN(C(=O)OC(C)(C)C)c1ncccc1C1CCCCN1CC |
| InChI | InChI=1S/C20H33N3O2/c1-6-14-23(19(24)25-20(3,4)5)18-16(11-10-13-21-18)17-12-8-9-15-22(17)7-2/h10-11,13,17H,6-9,12,14-15H2,1-5H3 |
| InChIKey | SMSLOWVPRXZMIS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |