C23H39N3O2 — CID 124552679
tert-butyl N-[(2R)-butan-2-yl]-N-[3-[(2S)-1-butylpiperidin-2-yl]-2-pyridinyl]carbamate (PubChem CID 124552679) has the molecular formula C23H39N3O2 and a molecular weight of 389.58 g/mol. Its IUPAC name is tert-butyl N-[(2R)-butan-2-yl]-N-[3-[(2S)-1-butylpiperidin-2-yl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-butan-2-yl]-N-[3-[(2S)-1-butylpiperidin-2-yl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 124552679 |
| Molecular Formula | C23H39N3O2 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.30 |
| IUPAC Name | tert-butyl N-[(2R)-butan-2-yl]-N-[3-[(2S)-1-butylpiperidin-2-yl]-2-pyridinyl]carbamate |
| SMILES | CCCCN1CCCC[C@H]1c1cccnc1N(C(=O)OC(C)(C)C)[C@H](C)CC |
| InChI | InChI=1S/C23H39N3O2/c1-7-9-16-25-17-11-10-14-20(25)19-13-12-15-24-21(19)26(18(3)8-2)22(27)28-23(4,5)6/h12-13,15,18,20H,7-11,14,16-17H2,1-6H3/t18-,20+/m1/s1 |
| InChIKey | IJIFHVIXKRFLBL-QUCCMNQESA-N |
| XLogP | 5.95 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |