C19H29N3O3 — CID 102541084
tert-butyl N-butan-2-yl-N-[3-(1-formylpyrrolidin-2-yl)-2-pyridinyl]carbamate (PubChem CID 102541084) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl N-butan-2-yl-N-[3-(1-formylpyrrolidin-2-yl)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-butan-2-yl-N-[3-(1-formylpyrrolidin-2-yl)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 102541084 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | tert-butyl N-butan-2-yl-N-[3-(1-formylpyrrolidin-2-yl)-2-pyridinyl]carbamate |
| SMILES | CCC(C)N(C(=O)OC(C)(C)C)c1ncccc1C1CCCN1C=O |
| InChI | InChI=1S/C19H29N3O3/c1-6-14(2)22(18(24)25-19(3,4)5)17-15(9-7-11-20-17)16-10-8-12-21(16)13-23/h7,9,11,13-14,16H,6,8,10,12H2,1-5H3 |
| InChIKey | SMVIHOBVAVRNNK-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|