C21H35N3O2 — CID 124552672
tert-butyl N-[(2R)-butan-2-yl]-N-[3-[(2R)-1-propylpyrrolidin-2-yl]-2-pyridinyl]carbamate (PubChem CID 124552672) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is tert-butyl N-[(2R)-butan-2-yl]-N-[3-[(2R)-1-propylpyrrolidin-2-yl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-butan-2-yl]-N-[3-[(2R)-1-propylpyrrolidin-2-yl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 124552672 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | tert-butyl N-[(2R)-butan-2-yl]-N-[3-[(2R)-1-propylpyrrolidin-2-yl]-2-pyridinyl]carbamate |
| SMILES | CCCN1CCC[C@@H]1c1cccnc1N(C(=O)OC(C)(C)C)[C@H](C)CC |
| InChI | InChI=1S/C21H35N3O2/c1-7-14-23-15-10-12-18(23)17-11-9-13-22-19(17)24(16(3)8-2)20(25)26-21(4,5)6/h9,11,13,16,18H,7-8,10,12,14-15H2,1-6H3/t16-,18-/m1/s1 |
| InChIKey | ACNVLENRHNVGCA-SJLPKXTDSA-N |
| XLogP | 5.17 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |