C20H35N3 — CID 102540016
3-(1-butylpiperidin-2-yl)-N,N-di(propan-2-yl)pyridin-2-amine (PubChem CID 102540016) has the molecular formula C20H35N3 and a molecular weight of 317.52 g/mol. Its IUPAC name is 3-(1-butylpiperidin-2-yl)-N,N-di(propan-2-yl)pyridin-2-amine.
| Compound Name | 3-(1-butylpiperidin-2-yl)-N,N-di(propan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 102540016 |
| Molecular Formula | C20H35N3 |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.28 |
| IUPAC Name | 3-(1-butylpiperidin-2-yl)-N,N-di(propan-2-yl)pyridin-2-amine |
| SMILES | CCCCN1CCCCC1c1cccnc1N(C(C)C)C(C)C |
| InChI | InChI=1S/C20H35N3/c1-6-7-14-22-15-9-8-12-19(22)18-11-10-13-21-20(18)23(16(2)3)17(4)5/h10-11,13,16-17,19H,6-9,12,14-15H2,1-5H3 |
| InChIKey | TTYYIZBTUGIFGM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |