C25H36N4O6S — CID 91157335
tert-butyl N-[3-[[1-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4,5-dimethoxyphenyl]pyrrolidin-3-yl]methylamino]propyl]carbamate (PubChem CID 91157335) has the molecular formula C25H36N4O6S and a molecular weight of 520.65 g/mol. Its IUPAC name is tert-butyl N-[3-[[1-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4,5-dimethoxyphenyl]pyrrolidin-3-yl]methylamino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[1-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4,5-dimethoxyphenyl]pyrrolidin-3-yl]methylamino]propyl]carbamate |
|---|---|
| PubChem CID | 91157335 |
| Molecular Formula | C25H36N4O6S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | tert-butyl N-[3-[[1-[2-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-4,5-dimethoxyphenyl]pyrrolidin-3-yl]methylamino]propyl]carbamate |
| SMILES | COc1cc(C=C2SC(=O)NC2=O)c(N2CCC(CNCCCNC(=O)OC(C)(C)C)C2)cc1OC |
| InChI | InChI=1S/C25H36N4O6S/c1-25(2,3)35-23(31)27-9-6-8-26-14-16-7-10-29(15-16)18-13-20(34-5)19(33-4)11-17(18)12-21-22(30)28-24(32)36-21/h11-13,16,26H,6-10,14-15H2,1-5H3,(H,27,31)(H,28,30,32) |
| InChIKey | MFKYTVCQJAHNOZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|