C20H25N3O5S — CID 58423258
tert-butyl N-[(3S)-1-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl]pyrrolidin-3-yl]carbamate (PubChem CID 58423258) has the molecular formula C20H25N3O5S and a molecular weight of 419.50 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 58423258 |
| Molecular Formula | C20H25N3O5S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | tert-butyl N-[(3S)-1-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-methoxyphenyl]pyrrolidin-3-yl]carbamate |
| SMILES | COc1cccc(/C=C2\SC(=O)NC2=O)c1N1CC[C@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H25N3O5S/c1-20(2,3)28-18(25)21-13-8-9-23(11-13)16-12(6-5-7-14(16)27-4)10-15-17(24)22-19(26)29-15/h5-7,10,13H,8-9,11H2,1-4H3,(H,21,25)(H,22,24,26)/b15-10-/t13-/m0/s1 |
| InChIKey | CNMMXYUTRISSTD-OJNRTJSBSA-N |
| XLogP | 3.12 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|