C20H24ClN3O5S — CID 140567657
tert-butyl N-[1-[2-chloro-6-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]-4-hydroxypiperidin-3-yl]carbamate (PubChem CID 140567657) has the molecular formula C20H24ClN3O5S and a molecular weight of 453.95 g/mol. Its IUPAC name is tert-butyl N-[1-[2-chloro-6-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]-4-hydroxypiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-chloro-6-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]-4-hydroxypiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 140567657 |
| Molecular Formula | C20H24ClN3O5S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | tert-butyl N-[1-[2-chloro-6-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]-4-hydroxypiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CN(c2c(Cl)cccc2/C=C2\SC(=O)NC2=O)CCC1O |
| InChI | InChI=1S/C20H24ClN3O5S/c1-20(2,3)29-18(27)22-13-10-24(8-7-14(13)25)16-11(5-4-6-12(16)21)9-15-17(26)23-19(28)30-15/h4-6,9,13-14,25H,7-8,10H2,1-3H3,(H,22,27)(H,23,26,28)/b15-9- |
| InChIKey | ZMTZPQCJIKMAEJ-DHDCSXOGSA-N |
| XLogP | 3.13 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|