C23H31N3O6S — CID 87386311
tert-butyl N-[(3R)-1-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(2-methoxyethoxy)phenyl]piperidin-3-yl]carbamate (PubChem CID 87386311) has the molecular formula C23H31N3O6S and a molecular weight of 477.58 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(2-methoxyethoxy)phenyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(2-methoxyethoxy)phenyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 87386311 |
| Molecular Formula | C23H31N3O6S |
| Molecular Weight | 477.58 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | tert-butyl N-[(3R)-1-[2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(2-methoxyethoxy)phenyl]piperidin-3-yl]carbamate |
| SMILES | COCCOc1cccc(/C=C2\SC(=O)NC2=O)c1N1CCC[C@@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C23H31N3O6S/c1-23(2,3)32-21(28)24-16-8-6-10-26(14-16)19-15(13-18-20(27)25-22(29)33-18)7-5-9-17(19)31-12-11-30-4/h5,7,9,13,16H,6,8,10-12,14H2,1-4H3,(H,24,28)(H,25,27,29)/b18-13-/t16-/m1/s1 |
| InChIKey | FNCUHHSWUTVLIE-OKSBFYSISA-N |
| XLogP | 3.53 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|