C17H21N5O4S — CID 53252079
tert-butyl N-[1-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]pyrrolidin-3-yl]carbamate (PubChem CID 53252079) has the molecular formula C17H21N5O4S and a molecular weight of 391.45 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 53252079 |
| Molecular Formula | C17H21N5O4S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | tert-butyl N-[1-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(c2nccc(/C=C3\SC(=O)NC3=O)n2)C1 |
| InChI | InChI=1S/C17H21N5O4S/c1-17(2,3)26-15(24)20-11-5-7-22(9-11)14-18-6-4-10(19-14)8-12-13(23)21-16(25)27-12/h4,6,8,11H,5,7,9H2,1-3H3,(H,20,24)(H,21,23,25)/b12-8- |
| InChIKey | XPKVPHGGKMFWNO-WQLSENKSSA-N |
| XLogP | 1.90 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|