C19H25N5O4S — CID 58312863
tert-butyl N-[[1-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-3-yl]methyl]carbamate (PubChem CID 58312863) has the molecular formula C19H25N5O4S and a molecular weight of 419.51 g/mol. Its IUPAC name is tert-butyl N-[[1-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 58312863 |
| Molecular Formula | C19H25N5O4S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | tert-butyl N-[[1-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1CCCN(c2nccc(/C=C3\SC(=O)NC3=O)n2)C1 |
| InChI | InChI=1S/C19H25N5O4S/c1-19(2,3)28-17(26)21-10-12-5-4-8-24(11-12)16-20-7-6-13(22-16)9-14-15(25)23-18(27)29-14/h6-7,9,12H,4-5,8,10-11H2,1-3H3,(H,21,26)(H,23,25,27)/b14-9- |
| InChIKey | STYVDLPBRZBGJC-ZROIWOOFSA-N |
| XLogP | 2.54 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|