C20H28N6O2S — CID 123919815
5-[[2-[4-[(piperidin-3-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 123919815) has the molecular formula C20H28N6O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is 5-[[2-[4-[(piperidin-3-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[4-[(piperidin-3-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 123919815 |
| Molecular Formula | C20H28N6O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 5-[[2-[4-[(piperidin-3-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(N3CCC(CNCC4CCCNC4)CC3)n2)S1 |
| InChI | InChI=1S/C20H28N6O2S/c27-18-17(29-20(28)25-18)10-16-3-7-23-19(24-16)26-8-4-14(5-9-26)11-22-13-15-2-1-6-21-12-15/h3,7,10,14-15,21-22H,1-2,4-6,8-9,11-13H2,(H,25,27,28) |
| InChIKey | LPIHELXDLSLFNQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|