C19H21N5O2S2 — CID 89077850
(5E)-5-[[2-[4-[(thiophen-2-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 89077850) has the molecular formula C19H21N5O2S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is (5E)-5-[[2-[4-[(thiophen-2-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-[4-[(thiophen-2-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89077850 |
| Molecular Formula | C19H21N5O2S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | (5E)-5-[[2-[4-[(thiophen-2-ylmethylamino)methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccnc(N3CCC(CNCc4cccs4)CC3)n2)S1 |
| InChI | InChI=1S/C19H21N5O2S2/c25-17-16(28-19(26)23-17)10-14-3-6-21-18(22-14)24-7-4-13(5-8-24)11-20-12-15-2-1-9-27-15/h1-3,6,9-10,13,20H,4-5,7-8,11-12H2,(H,23,25,26)/b16-10+ |
| InChIKey | YUAKCRWKTPZVGL-MHWRWJLKSA-N |
| XLogP | 2.87 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|