C20H23N7O2S2 — CID 89077618
(5E)-5-[[2-[4-[[(2-methylsulfanylpyrimidin-4-yl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 89077618) has the molecular formula C20H23N7O2S2 and a molecular weight of 457.59 g/mol. Its IUPAC name is (5E)-5-[[2-[4-[[(2-methylsulfanylpyrimidin-4-yl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-[4-[[(2-methylsulfanylpyrimidin-4-yl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89077618 |
| Molecular Formula | C20H23N7O2S2 |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | (5E)-5-[[2-[4-[[(2-methylsulfanylpyrimidin-4-yl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CSc1nccc(CNCC2CCN(c3nccc(/C=C4/SC(=O)NC4=O)n3)CC2)n1 |
| InChI | InChI=1S/C20H23N7O2S2/c1-30-19-23-7-3-15(25-19)12-21-11-13-4-8-27(9-5-13)18-22-6-2-14(24-18)10-16-17(28)26-20(29)31-16/h2-3,6-7,10,13,21H,4-5,8-9,11-12H2,1H3,(H,26,28,29)/b16-10+ |
| InChIKey | HLGWSTNBCOXOPY-MHWRWJLKSA-N |
| XLogP | 2.32 |
| TPSA | 113.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|