C24H29N7O2S — CID 89077755
(5E)-5-[[2-[4-[[(5-pyrrolidin-2-yl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 89077755) has the molecular formula C24H29N7O2S and a molecular weight of 479.61 g/mol. Its IUPAC name is (5E)-5-[[2-[4-[[(5-pyrrolidin-2-yl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[2-[4-[[(5-pyrrolidin-2-yl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 89077755 |
| Molecular Formula | C24H29N7O2S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (5E)-5-[[2-[4-[[(5-pyrrolidin-2-yl-2-pyridinyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccnc(N3CCC(CNCc4ccc(C5CCCN5)cn4)CC3)n2)S1 |
| InChI | InChI=1S/C24H29N7O2S/c32-22-21(34-24(33)30-22)12-18-5-9-27-23(29-18)31-10-6-16(7-11-31)13-25-15-19-4-3-17(14-28-19)20-2-1-8-26-20/h3-5,9,12,14,16,20,25-26H,1-2,6-8,10-11,13,15H2,(H,30,32,33)/b21-12+ |
| InChIKey | KKLOOIFPEMQSKX-CIAFOILYSA-N |
| XLogP | 2.63 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|