C19H19N7O3S — CID 76757013
N-[[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-4-yl]methyl]pyrazine-2-carboxamide (PubChem CID 76757013) has the molecular formula C19H19N7O3S and a molecular weight of 425.47 g/mol. Its IUPAC name is N-[[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-4-yl]methyl]pyrazine-2-carboxamide.
| Compound Name | N-[[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-4-yl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 76757013 |
| Molecular Formula | C19H19N7O3S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | N-[[1-[4-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]pyrimidin-2-yl]piperidin-4-yl]methyl]pyrazine-2-carboxamide |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(N3CCC(CNC(=O)c4cnccn4)CC3)n2)S1 |
| InChI | InChI=1S/C19H19N7O3S/c27-16(14-11-20-5-6-21-14)23-10-12-2-7-26(8-3-12)18-22-4-1-13(24-18)9-15-17(28)25-19(29)30-15/h1,4-6,9,11-12H,2-3,7-8,10H2,(H,23,27)(H,25,28,29) |
| InChIKey | OMQUSLNEHDZZPD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 130.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|