C30H28N6O2S — CID 154062163
5-[[2-[4-[[(2-isoquinolin-5-ylphenyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 154062163) has the molecular formula C30H28N6O2S and a molecular weight of 536.66 g/mol. Its IUPAC name is 5-[[2-[4-[[(2-isoquinolin-5-ylphenyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[2-[4-[[(2-isoquinolin-5-ylphenyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 154062163 |
| Molecular Formula | C30H28N6O2S |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 5-[[2-[4-[[(2-isoquinolin-5-ylphenyl)methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(=Cc2ccnc(N3CCC(CNCc4ccccc4-c4cccc5cnccc45)CC3)n2)S1 |
| InChI | InChI=1S/C30H28N6O2S/c37-28-27(39-30(38)35-28)16-23-8-13-33-29(34-23)36-14-10-20(11-15-36)17-32-19-21-4-1-2-6-24(21)26-7-3-5-22-18-31-12-9-25(22)26/h1-9,12-13,16,18,20,32H,10-11,14-15,17,19H2,(H,35,37,38) |
| InChIKey | OZSNMLBJXNQCML-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|