C24H33N3O5S — CID 87386489
tert-butyl N-[1-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(2-methylpropoxy)phenyl]piperidin-3-yl]carbamate (PubChem CID 87386489) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(2-methylpropoxy)phenyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(2-methylpropoxy)phenyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 87386489 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | tert-butyl N-[1-[2-[(E)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-6-(2-methylpropoxy)phenyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)COc1cccc(/C=C2/SC(=O)NC2=O)c1N1CCCC(NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H33N3O5S/c1-15(2)14-31-18-10-6-8-16(12-19-21(28)26-23(30)33-19)20(18)27-11-7-9-17(13-27)25-22(29)32-24(3,4)5/h6,8,10,12,15,17H,7,9,11,13-14H2,1-5H3,(H,25,29)(H,26,28,30)/b19-12+ |
| InChIKey | VDFYJYHWXUJWOI-XDHOZWIPSA-N |
| XLogP | 4.54 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|