C18H21ClN4O3S — CID 123313798
N-[(3S)-1-[2-chloro-6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]pyrrolidin-3-yl]-2-(dimethylamino)acetamide (PubChem CID 123313798) has the molecular formula C18H21ClN4O3S and a molecular weight of 408.91 g/mol. Its IUPAC name is N-[(3S)-1-[2-chloro-6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]pyrrolidin-3-yl]-2-(dimethylamino)acetamide.
| Compound Name | N-[(3S)-1-[2-chloro-6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]pyrrolidin-3-yl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 123313798 |
| Molecular Formula | C18H21ClN4O3S |
| Molecular Weight | 408.91 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | N-[(3S)-1-[2-chloro-6-[(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]pyrrolidin-3-yl]-2-(dimethylamino)acetamide |
| SMILES | CN(C)CC(=O)N[C@H]1CCN(c2c(Cl)cccc2C=C2SC(=O)NC2=O)C1 |
| InChI | InChI=1S/C18H21ClN4O3S/c1-22(2)10-15(24)20-12-6-7-23(9-12)16-11(4-3-5-13(16)19)8-14-17(25)21-18(26)27-14/h3-5,8,12H,6-7,9-10H2,1-2H3,(H,20,24)(H,21,25,26)/t12-/m0/s1 |
| InChIKey | ALFVXSXQXVFWAW-LBPRGKRZSA-N |
| XLogP | 1.92 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.91 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|