C21H28ClN3O2S — CID 75081681
5-[[3-chloro-2-[3-(dipropylamino)piperidin-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 75081681) has the molecular formula C21H28ClN3O2S and a molecular weight of 421.99 g/mol. Its IUPAC name is 5-[[3-chloro-2-[3-(dipropylamino)piperidin-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[3-chloro-2-[3-(dipropylamino)piperidin-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 75081681 |
| Molecular Formula | C21H28ClN3O2S |
| Molecular Weight | 421.99 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 5-[[3-chloro-2-[3-(dipropylamino)piperidin-1-yl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCN(CCC)C1CCCN(c2c(Cl)cccc2C=C2SC(=O)NC2=O)C1 |
| InChI | InChI=1S/C21H28ClN3O2S/c1-3-10-24(11-4-2)16-8-6-12-25(14-16)19-15(7-5-9-17(19)22)13-18-20(26)23-21(27)28-18/h5,7,9,13,16H,3-4,6,8,10-12,14H2,1-2H3,(H,23,26,27) |
| InChIKey | STVUNYMVAGCJLS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.99 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|