C19H24ClN3O2S — CID 143920385
(5Z)-5-[[2-[(3R)-3-(butylamino)piperidin-1-yl]-3-chlorophenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 143920385) has the molecular formula C19H24ClN3O2S and a molecular weight of 393.94 g/mol. Its IUPAC name is (5Z)-5-[[2-[(3R)-3-(butylamino)piperidin-1-yl]-3-chlorophenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[(3R)-3-(butylamino)piperidin-1-yl]-3-chlorophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 143920385 |
| Molecular Formula | C19H24ClN3O2S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | (5Z)-5-[[2-[(3R)-3-(butylamino)piperidin-1-yl]-3-chlorophenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCN[C@@H]1CCCN(c2c(Cl)cccc2/C=C2\SC(=O)NC2=O)C1 |
| InChI | InChI=1S/C19H24ClN3O2S/c1-2-3-9-21-14-7-5-10-23(12-14)17-13(6-4-8-15(17)20)11-16-18(24)22-19(25)26-16/h4,6,8,11,14,21H,2-3,5,7,9-10,12H2,1H3,(H,22,24,25)/b16-11-/t14-/m1/s1 |
| InChIKey | SUKWCEIHXRPBAE-VQCBNXJZSA-N |
| XLogP | 4.02 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|