C20H26ClN3O4S — CID 91255242
tert-butyl N-[1-[2-chloro-6-[(2-hydroxy-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperidin-3-yl]carbamate (PubChem CID 91255242) has the molecular formula C20H26ClN3O4S and a molecular weight of 439.97 g/mol. Its IUPAC name is tert-butyl N-[1-[2-chloro-6-[(2-hydroxy-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-chloro-6-[(2-hydroxy-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 91255242 |
| Molecular Formula | C20H26ClN3O4S |
| Molecular Weight | 439.97 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | tert-butyl N-[1-[2-chloro-6-[(2-hydroxy-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCCN(c2c(Cl)cccc2C=C2SC(O)NC2=O)C1 |
| InChI | InChI=1S/C20H26ClN3O4S/c1-20(2,3)28-18(26)22-13-7-5-9-24(11-13)16-12(6-4-8-14(16)21)10-15-17(25)23-19(27)29-15/h4,6,8,10,13,19,27H,5,7,9,11H2,1-3H3,(H,22,26)(H,23,25) |
| InChIKey | WRHCFRVRNWKADG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.97 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|