C25H35ClN4O4S — CID 143920472
tert-butyl N-[2-[[1-[2-[(Z)-(4-amino-3,6-dioxothian-2-ylidene)methyl]-6-chlorophenyl]piperidin-3-yl]amino]ethyl]-N-methylcarbamate (PubChem CID 143920472) has the molecular formula C25H35ClN4O4S and a molecular weight of 523.10 g/mol. Its IUPAC name is tert-butyl N-[2-[[1-[2-[(Z)-(4-amino-3,6-dioxothian-2-ylidene)methyl]-6-chlorophenyl]piperidin-3-yl]amino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[1-[2-[(Z)-(4-amino-3,6-dioxothian-2-ylidene)methyl]-6-chlorophenyl]piperidin-3-yl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 143920472 |
| Molecular Formula | C25H35ClN4O4S |
| Molecular Weight | 523.10 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | tert-butyl N-[2-[[1-[2-[(Z)-(4-amino-3,6-dioxothian-2-ylidene)methyl]-6-chlorophenyl]piperidin-3-yl]amino]ethyl]-N-methylcarbamate |
| SMILES | CN(CCNC1CCCN(c2c(Cl)cccc2/C=C2\SC(=O)CC(N)C2=O)C1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H35ClN4O4S/c1-25(2,3)34-24(33)29(4)12-10-28-17-8-6-11-30(15-17)22-16(7-5-9-18(22)26)13-20-23(32)19(27)14-21(31)35-20/h5,7,9,13,17,19,28H,6,8,10-12,14-15,27H2,1-4H3/b20-13- |
| InChIKey | RCFHGHIIZYZFFT-MOSHPQCFSA-N |
| XLogP | 3.67 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.10 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|