C22H27N3O5S — CID 58423195
tert-butyl 2-[(3R)-1-[4-carbamoyl-2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperidin-3-yl]acetate (PubChem CID 58423195) has the molecular formula C22H27N3O5S and a molecular weight of 445.54 g/mol. Its IUPAC name is tert-butyl 2-[(3R)-1-[4-carbamoyl-2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R)-1-[4-carbamoyl-2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 58423195 |
| Molecular Formula | C22H27N3O5S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | tert-butyl 2-[(3R)-1-[4-carbamoyl-2-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenyl]piperidin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1CCCN(c2ccc(C(N)=O)cc2/C=C2\SC(=O)NC2=O)C1 |
| InChI | InChI=1S/C22H27N3O5S/c1-22(2,3)30-18(26)9-13-5-4-8-25(12-13)16-7-6-14(19(23)27)10-15(16)11-17-20(28)24-21(29)31-17/h6-7,10-11,13H,4-5,8-9,12H2,1-3H3,(H2,23,27)(H,24,28,29)/b17-11-/t13-/m1/s1 |
| InChIKey | XEJQLONDBYRBKR-GPLLRDDGSA-N |
| XLogP | 3.06 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|