C22H31NO4 — CID 58423289
tert-butyl 2-[(3S)-1-(2-cyclobutyloxy-6-formylphenyl)piperidin-3-yl]acetate (PubChem CID 58423289) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is tert-butyl 2-[(3S)-1-(2-cyclobutyloxy-6-formylphenyl)piperidin-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3S)-1-(2-cyclobutyloxy-6-formylphenyl)piperidin-3-yl]acetate |
|---|---|
| PubChem CID | 58423289 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | tert-butyl 2-[(3S)-1-(2-cyclobutyloxy-6-formylphenyl)piperidin-3-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@@H]1CCCN(c2c(C=O)cccc2OC2CCC2)C1 |
| InChI | InChI=1S/C22H31NO4/c1-22(2,3)27-20(25)13-16-7-6-12-23(14-16)21-17(15-24)8-4-11-19(21)26-18-9-5-10-18/h4,8,11,15-16,18H,5-7,9-10,12-14H2,1-3H3/t16-/m0/s1 |
| InChIKey | NVVPEZXHFVCDCK-INIZCTEOSA-N |
| XLogP | 4.38 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|