C20H24N2O5 — CID 126598466
tert-butyl 3-(7-formyl-6-hydroxyquinolin-4-yl)oxypiperidine-1-carboxylate (PubChem CID 126598466) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is tert-butyl 3-(7-formyl-6-hydroxyquinolin-4-yl)oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(7-formyl-6-hydroxyquinolin-4-yl)oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 126598466 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | tert-butyl 3-(7-formyl-6-hydroxyquinolin-4-yl)oxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Oc2ccnc3cc(C=O)c(O)cc23)C1 |
| InChI | InChI=1S/C20H24N2O5/c1-20(2,3)27-19(25)22-8-4-5-14(11-22)26-18-6-7-21-16-9-13(12-23)17(24)10-15(16)18/h6-7,9-10,12,14,24H,4-5,8,11H2,1-3H3 |
| InChIKey | BEHFPQRMCCEHRC-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|