C19H24N2O3 — CID 118114502
tert-butyl 3-isoquinolin-1-yloxypiperidine-1-carboxylate (PubChem CID 118114502) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is tert-butyl 3-isoquinolin-1-yloxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-isoquinolin-1-yloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 118114502 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | tert-butyl 3-isoquinolin-1-yloxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(Oc2nccc3ccccc23)C1 |
| InChI | InChI=1S/C19H24N2O3/c1-19(2,3)24-18(22)21-12-6-8-15(13-21)23-17-16-9-5-4-7-14(16)10-11-20-17/h4-5,7,9-11,15H,6,8,12-13H2,1-3H3 |
| InChIKey | ZTEQKJXUGBTQKV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |