C20H30N4O4 — CID 122257425
tert-butyl 3-(3-pyrimidin-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate (PubChem CID 122257425) has the molecular formula C20H30N4O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is tert-butyl 3-(3-pyrimidin-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-pyrimidin-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 122257425 |
| Molecular Formula | C20H30N4O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | tert-butyl 3-(3-pyrimidin-2-yloxypiperidine-1-carbonyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)N2CCCC(Oc3ncccn3)C2)C1 |
| InChI | InChI=1S/C20H30N4O4/c1-20(2,3)28-19(26)24-12-4-7-15(13-24)17(25)23-11-5-8-16(14-23)27-18-21-9-6-10-22-18/h6,9-10,15-16H,4-5,7-8,11-14H2,1-3H3 |
| InChIKey | KXLSVOGTBFTCKC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 84.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |