C18H31N3O4 — CID 20614161
tert-butyl 3-[3-(methylcarbamoyl)piperidine-1-carbonyl]piperidine-1-carboxylate (PubChem CID 20614161) has the molecular formula C18H31N3O4 and a molecular weight of 353.46 g/mol. Its IUPAC name is tert-butyl 3-[3-(methylcarbamoyl)piperidine-1-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-(methylcarbamoyl)piperidine-1-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 20614161 |
| Molecular Formula | C18H31N3O4 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | tert-butyl 3-[3-(methylcarbamoyl)piperidine-1-carbonyl]piperidine-1-carboxylate |
| SMILES | CNC(=O)C1CCCN(C(=O)C2CCCN(C(=O)OC(C)(C)C)C2)C1 |
| InChI | InChI=1S/C18H31N3O4/c1-18(2,3)25-17(24)21-10-6-8-14(12-21)16(23)20-9-5-7-13(11-20)15(22)19-4/h13-14H,5-12H2,1-4H3,(H,19,22) |
| InChIKey | ONJGPTMBKZGNFV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |