C15H27N3O3 — CID 50986435
tert-butyl 3-(piperazine-1-carbonyl)piperidine-1-carboxylate (PubChem CID 50986435) has the molecular formula C15H27N3O3 and a molecular weight of 297.40 g/mol. Its IUPAC name is tert-butyl 3-(piperazine-1-carbonyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(piperazine-1-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 50986435 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | tert-butyl 3-(piperazine-1-carbonyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)N2CCNCC2)C1 |
| InChI | InChI=1S/C15H27N3O3/c1-15(2,3)21-14(20)18-8-4-5-12(11-18)13(19)17-9-6-16-7-10-17/h12,16H,4-11H2,1-3H3 |
| InChIKey | MCGRQQABSNLPCL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |