C16H29N3O3 — CID 50986434
tert-butyl 3-(4-aminopiperidine-1-carbonyl)piperidine-1-carboxylate (PubChem CID 50986434) has the molecular formula C16H29N3O3 and a molecular weight of 311.43 g/mol. Its IUPAC name is tert-butyl 3-(4-aminopiperidine-1-carbonyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-aminopiperidine-1-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 50986434 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | tert-butyl 3-(4-aminopiperidine-1-carbonyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)N2CCC(N)CC2)C1 |
| InChI | InChI=1S/C16H29N3O3/c1-16(2,3)22-15(21)19-8-4-5-12(11-19)14(20)18-9-6-13(17)7-10-18/h12-13H,4-11,17H2,1-3H3 |
| InChIKey | IDLASJBXNWOBRT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |