C11H23N3O2 — CID 175539972
tert-butyl 3,4-diaminoazepane-1-carboxylate (PubChem CID 175539972) has the molecular formula C11H23N3O2 and a molecular weight of 229.32 g/mol. Its IUPAC name is tert-butyl 3,4-diaminoazepane-1-carboxylate.
| Compound Name | tert-butyl 3,4-diaminoazepane-1-carboxylate |
|---|---|
| PubChem CID | 175539972 |
| Molecular Formula | C11H23N3O2 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | tert-butyl 3,4-diaminoazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(N)C(N)C1 |
| InChI | InChI=1S/C11H23N3O2/c1-11(2,3)16-10(15)14-6-4-5-8(12)9(13)7-14/h8-9H,4-7,12-13H2,1-3H3 |
| InChIKey | SEIKRPXEKIAOCU-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |