About zinc tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate
zinc tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate (PubChem CID 152945495) has the molecular formula C11H20NO2Zn+
and a molecular weight of 263.68 g/mol. Its IUPAC name is zinc tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate.
Molecular Properties
| Compound Name | zinc tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate |
| PubChem CID | 152945495 |
| Molecular Formula | C11H20NO2Zn+ |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | zinc tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate |
| SMILES | [CH2-][C@H]1CCCN(C(=O)OC(C)(C)C)C1.[Zn+2] |
| InChI | InChI=1S/C11H20NO2.Zn/c1-9-6-5-7-12(8-9)10(13)14-11(2,3)4;/h9H,1,5-8H2,2-4H3;/q-1;+2/t9-;/m0./s1 |
| InChIKey | NTRDXSCIYMHUHT-FVGYRXGTSA-N |
| XLogP | 2.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate?
The IUPAC name of zinc tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate (CID 152945495) is zinc tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate.
What is the SMILES notation for zinc tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate?
The canonical SMILES for zinc tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate is [CH2-][C@H]1CCCN(C(=O)OC(C)(C)C)C1.[Zn+2].
What is the InChIKey of zinc tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate?
The InChIKey is NTRDXSCIYMHUHT-FVGYRXGTSA-N. The full InChI is InChI=1S/C11H20NO2.Zn/c1-9-6-5-7-12(8-9)10(13)14-11(2,3)4;/h9H,1,5-8H2,2-4H3;/q-1;+2/t9-;/m0./s1.
What are the key properties of zinc tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate?
zinc tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate has a molecular weight of 263.68 g/mol, XLogP of 2.47, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for zinc tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate is sourced from PubChem (CID 152945495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).