C11H20FNO3 — CID 124556161
tert-butyl (3R,4S)-4-fluoro-3-hydroxyazepane-1-carboxylate (PubChem CID 124556161) has the molecular formula C11H20FNO3 and a molecular weight of 233.28 g/mol. Its IUPAC name is tert-butyl (3R,4S)-4-fluoro-3-hydroxyazepane-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-4-fluoro-3-hydroxyazepane-1-carboxylate |
|---|---|
| PubChem CID | 124556161 |
| Molecular Formula | C11H20FNO3 |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | tert-butyl (3R,4S)-4-fluoro-3-hydroxyazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](F)[C@H](O)C1 |
| InChI | InChI=1S/C11H20FNO3/c1-11(2,3)16-10(15)13-6-4-5-8(12)9(14)7-13/h8-9,14H,4-7H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | KFDVESWNQZBTDH-DTWKUNHWSA-N |
| XLogP | 1.72 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |