C12H23NO3 — CID 124523424
tert-butyl (3S,4S)-4-hydroxy-3-methylazepane-1-carboxylate (PubChem CID 124523424) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is tert-butyl (3S,4S)-4-hydroxy-3-methylazepane-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-4-hydroxy-3-methylazepane-1-carboxylate |
|---|---|
| PubChem CID | 124523424 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | tert-butyl (3S,4S)-4-hydroxy-3-methylazepane-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)CCC[C@@H]1O |
| InChI | InChI=1S/C12H23NO3/c1-9-8-13(7-5-6-10(9)14)11(15)16-12(2,3)4/h9-10,14H,5-8H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | QEPZXOOWHMYXGT-UWVGGRQHSA-N |
| XLogP | 2.01 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |