About tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate;iodozinc(1+)
tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate;iodozinc(1+) (PubChem CID 134128822) has the molecular formula C11H20INO2Zn
and a molecular weight of 390.58 g/mol. Its IUPAC name is tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate;iodozinc(1+).
Molecular Properties
| Compound Name | tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate;iodozinc(1+) |
| PubChem CID | 134128822 |
| Molecular Formula | C11H20INO2Zn |
| Molecular Weight | 390.58 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate;iodozinc(1+) |
| SMILES | [CH2-][C@H]1CCCN(C(=O)OC(C)(C)C)C1.[Zn+]I |
| InChI | InChI=1S/C11H20NO2.HI.Zn/c1-9-6-5-7-12(8-9)10(13)14-11(2,3)4;;/h9H,1,5-8H2,2-4H3;1H;/q-1;;+2/p-1/t9-;;/m0../s1 |
| InChIKey | RYIPBYLBBXNGBH-WWPIYYJJSA-M |
| XLogP | 3.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.58 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate;iodozinc(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate;iodozinc(1+)?
The IUPAC name of tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate;iodozinc(1+) (CID 134128822) is tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate;iodozinc(1+).
What is the SMILES notation for tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate;iodozinc(1+)?
The canonical SMILES for tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate;iodozinc(1+) is [CH2-][C@H]1CCCN(C(=O)OC(C)(C)C)C1.[Zn+]I.
What is the InChIKey of tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate;iodozinc(1+)?
The InChIKey is RYIPBYLBBXNGBH-WWPIYYJJSA-M. The full InChI is InChI=1S/C11H20NO2.HI.Zn/c1-9-6-5-7-12(8-9)10(13)14-11(2,3)4;;/h9H,1,5-8H2,2-4H3;1H;/q-1;;+2/p-1/t9-;;/m0../s1.
What are the key properties of tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate;iodozinc(1+)?
tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate;iodozinc(1+) has a molecular weight of 390.58 g/mol, XLogP of 3.35, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3S)-3-methanidylpiperidine-1-carboxylate;iodozinc(1+) is sourced from PubChem (CID 134128822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).