C16H30N4O3 — CID 84556160
tert-butyl 3-[(4-methylpiperazin-1-yl)carbamoyl]piperidine-1-carboxylate (PubChem CID 84556160) has the molecular formula C16H30N4O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is tert-butyl 3-[(4-methylpiperazin-1-yl)carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(4-methylpiperazin-1-yl)carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 84556160 |
| Molecular Formula | C16H30N4O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.23 |
| IUPAC Name | tert-butyl 3-[(4-methylpiperazin-1-yl)carbamoyl]piperidine-1-carboxylate |
| SMILES | CN1CCN(NC(=O)C2CCCN(C(=O)OC(C)(C)C)C2)CC1 |
| InChI | InChI=1S/C16H30N4O3/c1-16(2,3)23-15(22)19-7-5-6-13(12-19)14(21)17-20-10-8-18(4)9-11-20/h13H,5-12H2,1-4H3,(H,17,21) |
| InChIKey | BCKXUWDYEVPEGJ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |