C14H23N3O4 — CID 163488927
tert-butyl 3-[(cyclobutanecarbonylamino)carbamoyl]azetidine-1-carboxylate (PubChem CID 163488927) has the molecular formula C14H23N3O4 and a molecular weight of 297.35 g/mol. Its IUPAC name is tert-butyl 3-[(cyclobutanecarbonylamino)carbamoyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(cyclobutanecarbonylamino)carbamoyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 163488927 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | tert-butyl 3-[(cyclobutanecarbonylamino)carbamoyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C(=O)NNC(=O)C2CCC2)C1 |
| InChI | InChI=1S/C14H23N3O4/c1-14(2,3)21-13(20)17-7-10(8-17)12(19)16-15-11(18)9-5-4-6-9/h9-10H,4-8H2,1-3H3,(H,15,18)(H,16,19) |
| InChIKey | CKXWJUAETLXHJS-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|