C20H35ClN2O3 — CID 156566918
tert-butyl (3R,4S)-3-[(5-chlorocyclononanecarbonyl)amino]-4-methylpyrrolidine-1-carboxylate (PubChem CID 156566918) has the molecular formula C20H35ClN2O3 and a molecular weight of 386.96 g/mol. Its IUPAC name is tert-butyl (3R,4S)-3-[(5-chlorocyclononanecarbonyl)amino]-4-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4S)-3-[(5-chlorocyclononanecarbonyl)amino]-4-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 156566918 |
| Molecular Formula | C20H35ClN2O3 |
| Molecular Weight | 386.96 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | tert-butyl (3R,4S)-3-[(5-chlorocyclononanecarbonyl)amino]-4-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)C[C@@H]1NC(=O)C1CCCCC(Cl)CCC1 |
| InChI | InChI=1S/C20H35ClN2O3/c1-14-12-23(19(25)26-20(2,3)4)13-17(14)22-18(24)15-8-5-6-10-16(21)11-7-9-15/h14-17H,5-13H2,1-4H3,(H,22,24)/t14-,15?,16?,17-/m0/s1 |
| InChIKey | ODJHBLFHIUHYOZ-OTBWCIGPSA-N |
| XLogP | 4.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.96 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|