C16H25N5O6 — CID 90228983
tert-butyl 3-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]azetidine-1-carboxylate (PubChem CID 90228983) has the molecular formula C16H25N5O6 and a molecular weight of 383.41 g/mol. Its IUPAC name is tert-butyl 3-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 90228983 |
| Molecular Formula | C16H25N5O6 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | tert-butyl 3-[[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C(=O)NNC(=O)[C@@H]2CC[C@@H]3CN2C(=O)N3O)C1 |
| InChI | InChI=1S/C16H25N5O6/c1-16(2,3)27-15(25)19-6-9(7-19)12(22)17-18-13(23)11-5-4-10-8-20(11)14(24)21(10)26/h9-11,26H,4-8H2,1-3H3,(H,17,22)(H,18,23)/t10-,11+/m1/s1 |
| InChIKey | BCINXRPKYSILNH-MNOVXSKESA-N |
| XLogP | -0.34 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|