C17H27N5O6 — CID 141465935
tert-butyl (2S)-2-[[[(2R,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]pyrrolidine-1-carboxylate (PubChem CID 141465935) has the molecular formula C17H27N5O6 and a molecular weight of 397.43 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[[(2R,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[[[(2R,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 141465935 |
| Molecular Formula | C17H27N5O6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | tert-butyl (2S)-2-[[[(2R,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]carbamoyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)NNC(=O)[C@H]1CC[C@@H]2CN1C(=O)N2O |
| InChI | InChI=1S/C17H27N5O6/c1-17(2,3)28-16(26)20-8-4-5-11(20)13(23)18-19-14(24)12-7-6-10-9-21(12)15(25)22(10)27/h10-12,27H,4-9H2,1-3H3,(H,18,23)(H,19,24)/t10-,11+,12-/m1/s1 |
| InChIKey | VZLHFSSTQFWYQV-GRYCIOLGSA-N |
| XLogP | 0.19 |
| TPSA | 131.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|