C15H24N4O6 — CID 123671628
tert-butyl 3-[(6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl)amino]oxyazetidine-1-carboxylate (PubChem CID 123671628) has the molecular formula C15H24N4O6 and a molecular weight of 356.38 g/mol. Its IUPAC name is tert-butyl 3-[(6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl)amino]oxyazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl)amino]oxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 123671628 |
| Molecular Formula | C15H24N4O6 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | tert-butyl 3-[(6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl)amino]oxyazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(ONC(=O)C2CCC3CN2C(=O)N3O)C1 |
| InChI | InChI=1S/C15H24N4O6/c1-15(2,3)24-14(22)17-7-10(8-17)25-16-12(20)11-5-4-9-6-18(11)13(21)19(9)23/h9-11,23H,4-8H2,1-3H3,(H,16,20) |
| InChIKey | SKLOZQQIIJOZJO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|