C17H30N4O6 — CID 118073852
tert-butyl N-[2-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl]-N-propylcarbamate (PubChem CID 118073852) has the molecular formula C17H30N4O6 and a molecular weight of 386.45 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 118073852 |
| Molecular Formula | C17H30N4O6 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | tert-butyl N-[2-[[(2S,5R)-6-hydroxy-7-oxo-1,6-diazabicyclo[3.2.1]octane-2-carbonyl]amino]oxyethyl]-N-propylcarbamate |
| SMILES | CCCN(CCONC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30N4O6/c1-5-8-19(16(24)27-17(2,3)4)9-10-26-18-14(22)13-7-6-12-11-20(13)15(23)21(12)25/h12-13,25H,5-11H2,1-4H3,(H,18,22)/t12-,13+/m1/s1 |
| InChIKey | HECPIFYVYXVTLI-OLZOCXBDSA-N |
| XLogP | 1.34 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|